C42H68B2BaN12 — CID 139141227
barium(2+);bis(tris(3,5-diethylpyrazol-1-yl)boranuide) (PubChem CID 139141227) has the molecular formula C42H68B2BaN12 and a molecular weight of 900.04 g/mol. Its IUPAC name is barium(2+);bis(tris(3,5-diethylpyrazol-1-yl)boranuide).
| Compound Name | barium(2+);bis(tris(3,5-diethylpyrazol-1-yl)boranuide) |
|---|---|
| PubChem CID | 139141227 |
| Molecular Formula | C42H68B2BaN12 |
| Molecular Weight | 900.04 g/mol |
| Exact Mass | 900.49 |
| IUPAC Name | barium(2+);bis(tris(3,5-diethylpyrazol-1-yl)boranuide) |
| SMILES | CCc1cc(CC)n([BH-](n2nc(CC)cc2CC)n2nc(CC)cc2CC)n1.CCc1cc(CC)n([BH-](n2nc(CC)cc2CC)n2nc(CC)cc2CC)n1.[Ba+2] |
| InChI | InChI=1S/2C21H34BN6.Ba/c2*1-7-16-13-19(10-4)26(23-16)22(27-20(11-5)14-17(8-2)24-27)28-21(12-6)15-18(9-3)25-28;/h2*13-15,22H,7-12H2,1-6H3;/q2*-1;+2 |
| InChIKey | ZPKXZRHOLJPQIR-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 106.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.04 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|