C21H33BN6O3 — CID 91267043
tris(3,5-diethylpyrazol-1-yl) borate (PubChem CID 91267043) has the molecular formula C21H33BN6O3 and a molecular weight of 428.35 g/mol. Its IUPAC name is tris(3,5-diethylpyrazol-1-yl) borate.
| Compound Name | tris(3,5-diethylpyrazol-1-yl) borate |
|---|---|
| PubChem CID | 91267043 |
| Molecular Formula | C21H33BN6O3 |
| Molecular Weight | 428.35 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | tris(3,5-diethylpyrazol-1-yl) borate |
| SMILES | CCc1cc(CC)n(OB(On2nc(CC)cc2CC)On2nc(CC)cc2CC)n1 |
| InChI | InChI=1S/C21H33BN6O3/c1-7-16-13-19(10-4)26(23-16)29-22(30-27-20(11-5)14-17(8-2)24-27)31-28-21(12-6)15-18(9-3)25-28/h13-15H,7-12H2,1-6H3 |
| InChIKey | DZOBAXXFPNEDIV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 81.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|