C19H21ClN5O4+ — CID 78413788
2-[9-(3-chloro-2-methylphenyl)-1,7-dimethyl-2,4-dioxo-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-3-yl]acetic acid (PubChem CID 78413788) has the molecular formula C19H21ClN5O4+ and a molecular weight of 418.86 g/mol. Its IUPAC name is 2-[9-(3-chloro-2-methylphenyl)-1,7-dimethyl-2,4-dioxo-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-3-yl]acetic acid.
| Compound Name | 2-[9-(3-chloro-2-methylphenyl)-1,7-dimethyl-2,4-dioxo-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-3-yl]acetic acid |
|---|---|
| PubChem CID | 78413788 |
| Molecular Formula | C19H21ClN5O4+ |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-[9-(3-chloro-2-methylphenyl)-1,7-dimethyl-2,4-dioxo-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-3-yl]acetic acid |
| SMILES | Cc1c(Cl)cccc1N1CC(C)C[N+]2=C1N=C1C2C(=O)N(CC(=O)O)C(=O)N1C |
| InChI | InChI=1S/C19H20ClN5O4/c1-10-7-23(13-6-4-5-12(20)11(13)2)18-21-16-15(24(18)8-10)17(28)25(9-14(26)27)19(29)22(16)3/h4-6,10,15H,7-9H2,1-3H3/p+1 |
| InChIKey | YHEPKMHWPLSZIB-UHFFFAOYSA-O |
| XLogP | 1.23 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|