C19H30N5O2+ — CID 167998941
9-cyclohexyl-1,7-dimethyl-3-propyl-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione (PubChem CID 167998941) has the molecular formula C19H30N5O2+ and a molecular weight of 360.48 g/mol. Its IUPAC name is 9-cyclohexyl-1,7-dimethyl-3-propyl-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione.
| Compound Name | 9-cyclohexyl-1,7-dimethyl-3-propyl-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
|---|---|
| PubChem CID | 167998941 |
| Molecular Formula | C19H30N5O2+ |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 9-cyclohexyl-1,7-dimethyl-3-propyl-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
| SMILES | CCCN1C(=O)C2C(=NC3=[N+]2CC(C)CN3C2CCCCC2)N(C)C1=O |
| InChI | InChI=1S/C19H30N5O2/c1-4-10-22-17(25)15-16(21(3)19(22)26)20-18-23(11-13(2)12-24(15)18)14-8-6-5-7-9-14/h13-15H,4-12H2,1-3H3/q+1 |
| InChIKey | XOVCAOAXTGEMMJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|