C19H30N5O3+ — CID 167999312
9-cyclohexyl-3-(2-ethoxyethyl)-1-methyl-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione (PubChem CID 167999312) has the molecular formula C19H30N5O3+ and a molecular weight of 376.48 g/mol. Its IUPAC name is 9-cyclohexyl-3-(2-ethoxyethyl)-1-methyl-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione.
| Compound Name | 9-cyclohexyl-3-(2-ethoxyethyl)-1-methyl-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
|---|---|
| PubChem CID | 167999312 |
| Molecular Formula | C19H30N5O3+ |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 9-cyclohexyl-3-(2-ethoxyethyl)-1-methyl-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
| SMILES | CCOCCN1C(=O)C2C(=NC3=[N+]2CCCN3C2CCCCC2)N(C)C1=O |
| InChI | InChI=1S/C19H30N5O3/c1-3-27-13-12-24-17(25)15-16(21(2)19(24)26)20-18-22(10-7-11-23(15)18)14-8-5-4-6-9-14/h14-15H,3-13H2,1-2H3/q+1 |
| InChIKey | UZCXOQPUDLYSKJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|