C16H25N6O3+ — CID 167999691
1-(2-ethoxyethyl)-7-ethyl-3,4,9-trimethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione (PubChem CID 167999691) has the molecular formula C16H25N6O3+ and a molecular weight of 349.42 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-7-ethyl-3,4,9-trimethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione.
| Compound Name | 1-(2-ethoxyethyl)-7-ethyl-3,4,9-trimethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
|---|---|
| PubChem CID | 167999691 |
| Molecular Formula | C16H25N6O3+ |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 1-(2-ethoxyethyl)-7-ethyl-3,4,9-trimethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
| SMILES | CCOCCN1N=C(C)C(C)[N+]2=C1N=C1C2C(=O)N(CC)C(=O)N1C |
| InChI | InChI=1S/C16H25N6O3/c1-6-20-14(23)12-13(19(5)16(20)24)17-15-21(8-9-25-7-2)18-10(3)11(4)22(12)15/h11-12H,6-9H2,1-5H3/q+1 |
| InChIKey | DCYVDCIPEHNWLI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 80.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|