C22H20Cl2N5O3+ — CID 74776451
6-[3-[(2,6-dichlorophenyl)methoxy]phenyl]-2,4-dimethyl-8,9a-dihydro-7H-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 74776451) has the molecular formula C22H20Cl2N5O3+ and a molecular weight of 473.34 g/mol. Its IUPAC name is 6-[3-[(2,6-dichlorophenyl)methoxy]phenyl]-2,4-dimethyl-8,9a-dihydro-7H-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 6-[3-[(2,6-dichlorophenyl)methoxy]phenyl]-2,4-dimethyl-8,9a-dihydro-7H-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 74776451 |
| Molecular Formula | C22H20Cl2N5O3+ |
| Molecular Weight | 473.34 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 6-[3-[(2,6-dichlorophenyl)methoxy]phenyl]-2,4-dimethyl-8,9a-dihydro-7H-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | CN1C(=O)C2C(=NC3=[N+]2CCN3c2cccc(OCc3c(Cl)cccc3Cl)c2)N(C)C1=O |
| InChI | InChI=1S/C22H20Cl2N5O3/c1-26-19-18(20(30)27(2)22(26)31)29-10-9-28(21(29)25-19)13-5-3-6-14(11-13)32-12-15-16(23)7-4-8-17(15)24/h3-8,11,18H,9-10,12H2,1-2H3/q+1 |
| InChIKey | VHDGWDMQWKHMJF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|