C20H24ClN6O2+ — CID 73328078
6-[3-(4-chloroanilino)propyl]-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione (PubChem CID 73328078) has the molecular formula C20H24ClN6O2+ and a molecular weight of 415.91 g/mol. Its IUPAC name is 6-[3-(4-chloroanilino)propyl]-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione.
| Compound Name | 6-[3-(4-chloroanilino)propyl]-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
|---|---|
| PubChem CID | 73328078 |
| Molecular Formula | C20H24ClN6O2+ |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 6-[3-(4-chloroanilino)propyl]-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
| SMILES | Cc1c(C)[n+](CCCNc2ccc(Cl)cc2)c2n1C1C(=O)N(C)C(=O)N(C)C1=N2 |
| InChI | InChI=1S/C20H24ClN6O2/c1-12-13(2)27-16-17(24(3)20(29)25(4)18(16)28)23-19(27)26(12)11-5-10-22-15-8-6-14(21)7-9-15/h6-9,16,22H,5,10-11H2,1-4H3/q+1 |
| InChIKey | MENWIKWXDXZXKJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 73.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|