C17H29N6O4+ — CID 75608957
7-[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 75608957) has the molecular formula C17H29N6O4+ and a molecular weight of 381.46 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 75608957 |
| Molecular Formula | C17H29N6O4+ |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 7-[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | COCC1=[N+](CC(O)CN2CCN(C)CC2)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C17H29N6O4/c1-19-5-7-22(8-6-19)9-12(24)10-23-13(11-27-4)18-15-14(23)16(25)21(3)17(26)20(15)2/h12,14,24H,5-11H2,1-4H3/q+1 |
| InChIKey | CPRFWRGOOSDXBP-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|