C18H30N5O4+ — CID 74443587
7-(2,3-dihydroxypropyl)-8-[(3,5-dimethylpiperidin-1-yl)methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 74443587) has the molecular formula C18H30N5O4+ and a molecular weight of 380.47 g/mol. Its IUPAC name is 7-(2,3-dihydroxypropyl)-8-[(3,5-dimethylpiperidin-1-yl)methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-(2,3-dihydroxypropyl)-8-[(3,5-dimethylpiperidin-1-yl)methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74443587 |
| Molecular Formula | C18H30N5O4+ |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 7-(2,3-dihydroxypropyl)-8-[(3,5-dimethylpiperidin-1-yl)methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CC1CC(C)CN(CC2=[N+](CC(O)CO)C3C(=O)N(C)C(=O)N(C)C3=N2)C1 |
| InChI | InChI=1S/C18H30N5O4/c1-11-5-12(2)7-22(6-11)9-14-19-16-15(23(14)8-13(25)10-24)17(26)21(4)18(27)20(16)3/h11-13,15,24-25H,5-10H2,1-4H3/q+1 |
| InChIKey | DQPFIKSBVUJXRI-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|