C24H27N6O4+ — CID 156589644
7-(2-methoxyethyl)-1,3-dimethyl-8-[(2E)-2-[(4-phenylmethoxyphenyl)methylidene]hydrazinyl]-5H-purin-7-ium-2,6-dione (PubChem CID 156589644) has the molecular formula C24H27N6O4+ and a molecular weight of 463.52 g/mol. Its IUPAC name is 7-(2-methoxyethyl)-1,3-dimethyl-8-[(2E)-2-[(4-phenylmethoxyphenyl)methylidene]hydrazinyl]-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-(2-methoxyethyl)-1,3-dimethyl-8-[(2E)-2-[(4-phenylmethoxyphenyl)methylidene]hydrazinyl]-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 156589644 |
| Molecular Formula | C24H27N6O4+ |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 7-(2-methoxyethyl)-1,3-dimethyl-8-[(2E)-2-[(4-phenylmethoxyphenyl)methylidene]hydrazinyl]-5H-purin-7-ium-2,6-dione |
| SMILES | COCC[N+]1=C(N/N=C/c2ccc(OCc3ccccc3)cc2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C24H26N6O4/c1-28-21-20(22(31)29(2)24(28)32)30(13-14-33-3)23(26-21)27-25-15-17-9-11-19(12-10-17)34-16-18-7-5-4-6-8-18/h4-12,15,20H,13-14,16H2,1-3H3/p+1/b25-15+ |
| InChIKey | OHHLHXIZRCJAQL-MFKUBSTISA-O |
| XLogP | 1.51 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|