C29H30N6O3 — CID 45043449
1,3-dimethyl-7-(2-phenylethyl)-8-[(2E)-2-[(4-phenylmethoxyphenyl)methylidene]hydrazinyl]-4,5-dihydropurine-2,6-dione (PubChem CID 45043449) has the molecular formula C29H30N6O3 and a molecular weight of 510.60 g/mol. Its IUPAC name is 1,3-dimethyl-7-(2-phenylethyl)-8-[(2E)-2-[(4-phenylmethoxyphenyl)methylidene]hydrazinyl]-4,5-dihydropurine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-(2-phenylethyl)-8-[(2E)-2-[(4-phenylmethoxyphenyl)methylidene]hydrazinyl]-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 45043449 |
| Molecular Formula | C29H30N6O3 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 1,3-dimethyl-7-(2-phenylethyl)-8-[(2E)-2-[(4-phenylmethoxyphenyl)methylidene]hydrazinyl]-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)C2C(N=C(N/N=C/c3ccc(OCc4ccccc4)cc3)N2CCc2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C29H30N6O3/c1-33-26-25(27(36)34(2)29(33)37)35(18-17-21-9-5-3-6-10-21)28(31-26)32-30-19-22-13-15-24(16-14-22)38-20-23-11-7-4-8-12-23/h3-16,19,25-26H,17-18,20H2,1-2H3,(H,31,32)/b30-19+ |
| InChIKey | REUHKEFVOACFMX-NDZAJKAJSA-N |
| XLogP | 3.32 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|