C26H29N6O4+ — CID 11946912
(4S)-4-[2-[4-(cyclopropanecarbonyl)piperazin-1-ium-1-yl]ethyliminomethyl]-2-(4-nitrophenyl)-5-phenyl-4H-pyrazol-3-one (PubChem CID 11946912) has the molecular formula C26H29N6O4+ and a molecular weight of 489.56 g/mol. Its IUPAC name is (4S)-4-[2-[4-(cyclopropanecarbonyl)piperazin-1-ium-1-yl]ethyliminomethyl]-2-(4-nitrophenyl)-5-phenyl-4H-pyrazol-3-one.
| Compound Name | (4S)-4-[2-[4-(cyclopropanecarbonyl)piperazin-1-ium-1-yl]ethyliminomethyl]-2-(4-nitrophenyl)-5-phenyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 11946912 |
| Molecular Formula | C26H29N6O4+ |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | (4S)-4-[2-[4-(cyclopropanecarbonyl)piperazin-1-ium-1-yl]ethyliminomethyl]-2-(4-nitrophenyl)-5-phenyl-4H-pyrazol-3-one |
| SMILES | O=C(C1CC1)N1CC[NH+](CC/N=C/[C@@H]2C(=O)N(c3ccc([N+](=O)[O-])cc3)N=C2c2ccccc2)CC1 |
| InChI | InChI=1S/C26H28N6O4/c33-25(20-6-7-20)30-16-14-29(15-17-30)13-12-27-18-23-24(19-4-2-1-3-5-19)28-31(26(23)34)21-8-10-22(11-9-21)32(35)36/h1-5,8-11,18,20,23H,6-7,12-17H2/p+1/b27-18+/t23-/m0/s1 |
| InChIKey | JXCFWMDUSIVTSJ-UBCTUXONSA-O |
| XLogP | 1.17 |
| TPSA | 112.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|