C18H26N6O3+2 — CID 7182413
(4S)-5-methyl-4-[C-methyl-N-(2-piperazine-1,4-diium-1-ylethyl)carbonimidoyl]-2-(4-nitrophenyl)-4H-pyrazol-3-one (PubChem CID 7182413) has the molecular formula C18H26N6O3+2 and a molecular weight of 374.45 g/mol. Its IUPAC name is (4S)-5-methyl-4-[C-methyl-N-(2-piperazine-1,4-diium-1-ylethyl)carbonimidoyl]-2-(4-nitrophenyl)-4H-pyrazol-3-one.
| Compound Name | (4S)-5-methyl-4-[C-methyl-N-(2-piperazine-1,4-diium-1-ylethyl)carbonimidoyl]-2-(4-nitrophenyl)-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 7182413 |
| Molecular Formula | C18H26N6O3+2 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (4S)-5-methyl-4-[C-methyl-N-(2-piperazine-1,4-diium-1-ylethyl)carbonimidoyl]-2-(4-nitrophenyl)-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2ccc([N+](=O)[O-])cc2)C(=O)[C@H]1/C(C)=N/CC[NH+]1CC[NH2+]CC1 |
| InChI | InChI=1S/C18H24N6O3/c1-13(20-9-12-22-10-7-19-8-11-22)17-14(2)21-23(18(17)25)15-3-5-16(6-4-15)24(26)27/h3-6,17,19H,7-12H2,1-2H3/p+2/b20-13+/t17-/m0/s1 |
| InChIKey | SLPNHPBRUXJTNZ-NNIWKIFQSA-P |
| XLogP | -1.14 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|