C19H18N4O4 — CID 7471751
(4S)-4-[[(2S)-2-hydroxy-2-phenylethyl]iminomethyl]-5-methyl-2-(4-nitrophenyl)-4H-pyrazol-3-one (PubChem CID 7471751) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-hydroxy-2-phenylethyl]iminomethyl]-5-methyl-2-(4-nitrophenyl)-4H-pyrazol-3-one.
| Compound Name | (4S)-4-[[(2S)-2-hydroxy-2-phenylethyl]iminomethyl]-5-methyl-2-(4-nitrophenyl)-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 7471751 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (4S)-4-[[(2S)-2-hydroxy-2-phenylethyl]iminomethyl]-5-methyl-2-(4-nitrophenyl)-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2ccc([N+](=O)[O-])cc2)C(=O)[C@H]1/C=N/C[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C19H18N4O4/c1-13-17(11-20-12-18(24)14-5-3-2-4-6-14)19(25)22(21-13)15-7-9-16(10-8-15)23(26)27/h2-11,17-18,24H,12H2,1H3/b20-11+/t17-,18+/m0/s1 |
| InChIKey | OAYDBFFWFQHBLG-HLNVMSFQSA-N |
| XLogP | 2.74 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|