C19H23NO4 — CID 7335078
trans-methyl (1S,5S)-2,2-dimethyl-4,6-dioxo-5-(2-phenylethyliminomethyl)cyclohexane-1-carboxylate (PubChem CID 7335078) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is trans-methyl (1S,5S)-2,2-dimethyl-4,6-dioxo-5-(2-phenylethyliminomethyl)cyclohexane-1-carboxylate.
| Compound Name | trans-methyl (1S,5S)-2,2-dimethyl-4,6-dioxo-5-(2-phenylethyliminomethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 7335078 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | trans-methyl (1S,5S)-2,2-dimethyl-4,6-dioxo-5-(2-phenylethyliminomethyl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)[C@@H](/C=N/CCc2ccccc2)C(=O)CC1(C)C |
| InChI | InChI=1S/C19H23NO4/c1-19(2)11-15(21)14(17(22)16(19)18(23)24-3)12-20-10-9-13-7-5-4-6-8-13/h4-8,12,14,16H,9-11H2,1-3H3/b20-12+/t14-,16-/m0/s1 |
| InChIKey | ICRGCMWMPQSVHP-AHZNIFGXSA-N |
| XLogP | 2.27 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|