C17H14F3NO2 — CID 4143702
1,1,1-trifluoro-4-(4-phenylmethoxyanilino)but-3-en-2-one (PubChem CID 4143702) has the molecular formula C17H14F3NO2 and a molecular weight of 321.30 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(4-phenylmethoxyanilino)but-3-en-2-one.
| Compound Name | 1,1,1-trifluoro-4-(4-phenylmethoxyanilino)but-3-en-2-one |
|---|---|
| PubChem CID | 4143702 |
| Molecular Formula | C17H14F3NO2 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 1,1,1-trifluoro-4-(4-phenylmethoxyanilino)but-3-en-2-one |
| SMILES | O=C(C=CNc1ccc(OCc2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H14F3NO2/c18-17(19,20)16(22)10-11-21-14-6-8-15(9-7-14)23-12-13-4-2-1-3-5-13/h1-11,21H,12H2 |
| InChIKey | LZKHYLOWHSIJRQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|