C20H14F17NO3 — CID 12654232
ethyl (E)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-3-(4-methoxyanilino)undec-2-enoate (PubChem CID 12654232) has the molecular formula C20H14F17NO3 and a molecular weight of 639.30 g/mol. Its IUPAC name is ethyl (E)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-3-(4-methoxyanilino)undec-2-enoate.
| Compound Name | ethyl (E)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-3-(4-methoxyanilino)undec-2-enoate |
|---|---|
| PubChem CID | 12654232 |
| Molecular Formula | C20H14F17NO3 |
| Molecular Weight | 639.30 g/mol |
| Exact Mass | 639.07 |
| IUPAC Name | ethyl (E)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-3-(4-methoxyanilino)undec-2-enoate |
| SMILES | CCOC(=O)/C=C(/Nc1ccc(OC)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H14F17NO3/c1-3-41-12(39)8-11(38-9-4-6-10(40-2)7-5-9)13(21,22)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)20(35,36)37/h4-8,38H,3H2,1-2H3/b11-8+ |
| InChIKey | RWGHJGZHINRVOY-DHZHZOJOSA-N |
| XLogP | 7.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.30 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|