C19H12F16O3 — CID 132502674
ethyl (Z)-3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluoro-2-(4-methoxyphenyl)dec-2-enoate (PubChem CID 132502674) has the molecular formula C19H12F16O3 and a molecular weight of 592.27 g/mol. Its IUPAC name is ethyl (Z)-3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluoro-2-(4-methoxyphenyl)dec-2-enoate.
| Compound Name | ethyl (Z)-3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluoro-2-(4-methoxyphenyl)dec-2-enoate |
|---|---|
| PubChem CID | 132502674 |
| Molecular Formula | C19H12F16O3 |
| Molecular Weight | 592.27 g/mol |
| Exact Mass | 592.05 |
| IUPAC Name | ethyl (Z)-3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluoro-2-(4-methoxyphenyl)dec-2-enoate |
| SMILES | CCOC(=O)/C(=C(\F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H12F16O3/c1-3-38-12(36)10(8-4-6-9(37-2)7-5-8)11(20)13(21,22)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)35/h4-7H,3H2,1-2H3/b11-10- |
| InChIKey | ZRJQQIQALGWFKQ-KHPPLWFESA-N |
| XLogP | 7.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.27 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|