C11H7F6NO — CID 2842949
1,1,1-trifluoro-4-[3-(trifluoromethyl)anilino]but-3-en-2-one (PubChem CID 2842949) has the molecular formula C11H7F6NO and a molecular weight of 283.17 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-[3-(trifluoromethyl)anilino]but-3-en-2-one.
| Compound Name | 1,1,1-trifluoro-4-[3-(trifluoromethyl)anilino]but-3-en-2-one |
|---|---|
| PubChem CID | 2842949 |
| Molecular Formula | C11H7F6NO |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 1,1,1-trifluoro-4-[3-(trifluoromethyl)anilino]but-3-en-2-one |
| SMILES | O=C(C=CNc1cccc(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C11H7F6NO/c12-10(13,14)7-2-1-3-8(6-7)18-5-4-9(19)11(15,16)17/h1-6,18H |
| InChIKey | RFKAPZRAJMGVBU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|