C12H11F3N4O2 — CID 163566114
(Z)-2-imino-3-oxo-5-[3-(trifluoromethyl)anilino]pent-4-enehydrazide (PubChem CID 163566114) has the molecular formula C12H11F3N4O2 and a molecular weight of 300.24 g/mol. Its IUPAC name is (Z)-2-imino-3-oxo-5-[3-(trifluoromethyl)anilino]pent-4-enehydrazide.
| Compound Name | (Z)-2-imino-3-oxo-5-[3-(trifluoromethyl)anilino]pent-4-enehydrazide |
|---|---|
| PubChem CID | 163566114 |
| Molecular Formula | C12H11F3N4O2 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (Z)-2-imino-3-oxo-5-[3-(trifluoromethyl)anilino]pent-4-enehydrazide |
| SMILES | [H]/N=C(/C(=O)/C=C\Nc1cccc(C(F)(F)F)c1)C(=O)NN |
| InChI | InChI=1S/C12H11F3N4O2/c13-12(14,15)7-2-1-3-8(6-7)18-5-4-9(20)10(16)11(21)19-17/h1-6,16,18H,17H2,(H,19,21)/b5-4-,16-10- |
| InChIKey | FVIOUDBDJPKVJV-LRHKBYLLSA-N |
| XLogP | 1.21 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|