C11H7F3N2O — CID 102280038
2-[[(Z)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]benzonitrile (PubChem CID 102280038) has the molecular formula C11H7F3N2O and a molecular weight of 240.18 g/mol. Its IUPAC name is 2-[[(Z)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]benzonitrile.
| Compound Name | 2-[[(Z)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]benzonitrile |
|---|---|
| PubChem CID | 102280038 |
| Molecular Formula | C11H7F3N2O |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-[[(Z)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]benzonitrile |
| SMILES | N#Cc1ccccc1N/C=C\C(=O)C(F)(F)F |
| InChI | InChI=1S/C11H7F3N2O/c12-11(13,14)10(17)5-6-16-9-4-2-1-3-8(9)7-15/h1-6,16H/b6-5- |
| InChIKey | SJPNZIWCBKQQGI-WAYWQWQTSA-N |
| XLogP | 2.62 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|