C20H14F3N3O — CID 24827496
(E)-4-[(4,6-diphenylpyrimidin-2-yl)amino]-1,1,1-trifluorobut-3-en-2-one (PubChem CID 24827496) has the molecular formula C20H14F3N3O and a molecular weight of 369.35 g/mol. Its IUPAC name is (E)-4-[(4,6-diphenylpyrimidin-2-yl)amino]-1,1,1-trifluorobut-3-en-2-one.
| Compound Name | (E)-4-[(4,6-diphenylpyrimidin-2-yl)amino]-1,1,1-trifluorobut-3-en-2-one |
|---|---|
| PubChem CID | 24827496 |
| Molecular Formula | C20H14F3N3O |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (E)-4-[(4,6-diphenylpyrimidin-2-yl)amino]-1,1,1-trifluorobut-3-en-2-one |
| SMILES | O=C(/C=C/Nc1nc(-c2ccccc2)cc(-c2ccccc2)n1)C(F)(F)F |
| InChI | InChI=1S/C20H14F3N3O/c21-20(22,23)18(27)11-12-24-19-25-16(14-7-3-1-4-8-14)13-17(26-19)15-9-5-2-6-10-15/h1-13H,(H,24,25,26)/b12-11+ |
| InChIKey | AIGQTWFVIDXLTP-VAWYXSNFSA-N |
| XLogP | 4.87 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|