C14H7F3N4 — CID 10913190
[3-cyano-6-phenyl-4-(trifluoromethyl)-2-pyridinyl]cyanamide (PubChem CID 10913190) has the molecular formula C14H7F3N4 and a molecular weight of 288.23 g/mol. Its IUPAC name is [3-cyano-6-phenyl-4-(trifluoromethyl)-2-pyridinyl]cyanamide.
| Compound Name | [3-cyano-6-phenyl-4-(trifluoromethyl)-2-pyridinyl]cyanamide |
|---|---|
| PubChem CID | 10913190 |
| Molecular Formula | C14H7F3N4 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | [3-cyano-6-phenyl-4-(trifluoromethyl)-2-pyridinyl]cyanamide |
| SMILES | N#CNc1nc(-c2ccccc2)cc(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C14H7F3N4/c15-14(16,17)11-6-12(9-4-2-1-3-5-9)21-13(20-8-19)10(11)7-18/h1-6H,(H,20,21) |
| InChIKey | JUKIQBDOZZOVIF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|