C15H8F3N3S — CID 3135060
2-(cyanomethylsulfanyl)-6-phenyl-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 3135060) has the molecular formula C15H8F3N3S and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-(cyanomethylsulfanyl)-6-phenyl-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-(cyanomethylsulfanyl)-6-phenyl-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3135060 |
| Molecular Formula | C15H8F3N3S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-(cyanomethylsulfanyl)-6-phenyl-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#CCSc1nc(-c2ccccc2)cc(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C15H8F3N3S/c16-15(17,18)12-8-13(10-4-2-1-3-5-10)21-14(11(12)9-20)22-7-6-19/h1-5,8H,7H2 |
| InChIKey | WVEZCEVLMDNQHA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |