C16H10ClF3N2S — CID 5071343
6-(4-chlorophenyl)-2-prop-2-enylsulfanyl-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 5071343) has the molecular formula C16H10ClF3N2S and a molecular weight of 354.78 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-prop-2-enylsulfanyl-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 6-(4-chlorophenyl)-2-prop-2-enylsulfanyl-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5071343 |
| Molecular Formula | C16H10ClF3N2S |
| Molecular Weight | 354.78 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 6-(4-chlorophenyl)-2-prop-2-enylsulfanyl-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | C=CCSc1nc(-c2ccc(Cl)cc2)cc(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C16H10ClF3N2S/c1-2-7-23-15-12(9-21)13(16(18,19)20)8-14(22-15)10-3-5-11(17)6-4-10/h2-6,8H,1,7H2 |
| InChIKey | VLWYSCZAYYUADT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.78 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|