C23H25F5N2S2 — CID 18838195
6-[4-(difluoromethylsulfanyl)phenyl]-2-nonylsulfanyl-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 18838195) has the molecular formula C23H25F5N2S2 and a molecular weight of 488.59 g/mol. Its IUPAC name is 6-[4-(difluoromethylsulfanyl)phenyl]-2-nonylsulfanyl-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 6-[4-(difluoromethylsulfanyl)phenyl]-2-nonylsulfanyl-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18838195 |
| Molecular Formula | C23H25F5N2S2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 6-[4-(difluoromethylsulfanyl)phenyl]-2-nonylsulfanyl-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | CCCCCCCCCSc1nc(-c2ccc(SC(F)F)cc2)cc(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C23H25F5N2S2/c1-2-3-4-5-6-7-8-13-31-21-18(15-29)19(23(26,27)28)14-20(30-21)16-9-11-17(12-10-16)32-22(24)25/h9-12,14,22H,2-8,13H2,1H3 |
| InChIKey | JBGRWUZEXFLWGM-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|