C20H19F5N2OS — CID 18838130
6-[4-(difluoromethoxy)phenyl]-2-hexylsulfanyl-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 18838130) has the molecular formula C20H19F5N2OS and a molecular weight of 430.44 g/mol. Its IUPAC name is 6-[4-(difluoromethoxy)phenyl]-2-hexylsulfanyl-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 6-[4-(difluoromethoxy)phenyl]-2-hexylsulfanyl-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18838130 |
| Molecular Formula | C20H19F5N2OS |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 6-[4-(difluoromethoxy)phenyl]-2-hexylsulfanyl-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | CCCCCCSc1nc(-c2ccc(OC(F)F)cc2)cc(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C20H19F5N2OS/c1-2-3-4-5-10-29-18-15(12-26)16(20(23,24)25)11-17(27-18)13-6-8-14(9-7-13)28-19(21)22/h6-9,11,19H,2-5,10H2,1H3 |
| InChIKey | WKELFFBAAZGLHS-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|