C22H23F5N2S2 — CID 18838194
6-[4-(difluoromethylsulfanyl)phenyl]-2-octylsulfanyl-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 18838194) has the molecular formula C22H23F5N2S2 and a molecular weight of 474.56 g/mol. Its IUPAC name is 6-[4-(difluoromethylsulfanyl)phenyl]-2-octylsulfanyl-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 6-[4-(difluoromethylsulfanyl)phenyl]-2-octylsulfanyl-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18838194 |
| Molecular Formula | C22H23F5N2S2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 6-[4-(difluoromethylsulfanyl)phenyl]-2-octylsulfanyl-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | CCCCCCCCSc1nc(-c2ccc(SC(F)F)cc2)cc(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C22H23F5N2S2/c1-2-3-4-5-6-7-12-30-20-17(14-28)18(22(25,26)27)13-19(29-20)15-8-10-16(11-9-15)31-21(23)24/h8-11,13,21H,2-7,12H2,1H3 |
| InChIKey | RKTZHVCQNRQISQ-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|