C24H20F3N3O2S — CID 139582948
N-[2-[[3-cyano-6-(4-methoxyphenyl)-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-4-methylbenzamide (PubChem CID 139582948) has the molecular formula C24H20F3N3O2S and a molecular weight of 471.50 g/mol. Its IUPAC name is N-[2-[[3-cyano-6-(4-methoxyphenyl)-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-4-methylbenzamide.
| Compound Name | N-[2-[[3-cyano-6-(4-methoxyphenyl)-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 139582948 |
| Molecular Formula | C24H20F3N3O2S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | N-[2-[[3-cyano-6-(4-methoxyphenyl)-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-4-methylbenzamide |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)c(C#N)c(SCCNC(=O)c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C24H20F3N3O2S/c1-15-3-5-17(6-4-15)22(31)29-11-12-33-23-19(14-28)20(24(25,26)27)13-21(30-23)16-7-9-18(32-2)10-8-16/h3-10,13H,11-12H2,1-2H3,(H,29,31) |
| InChIKey | WUIXAWMTIHQZFS-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|