C25H20F3N3O3S — CID 4173039
2-[[3-cyano-6-(4-prop-2-enoxyphenyl)-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(4-methoxyphenyl)acetamide (PubChem CID 4173039) has the molecular formula C25H20F3N3O3S and a molecular weight of 499.51 g/mol. Its IUPAC name is 2-[[3-cyano-6-(4-prop-2-enoxyphenyl)-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[[3-cyano-6-(4-prop-2-enoxyphenyl)-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4173039 |
| Molecular Formula | C25H20F3N3O3S |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 2-[[3-cyano-6-(4-prop-2-enoxyphenyl)-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(4-methoxyphenyl)acetamide |
| SMILES | C=CCOc1ccc(-c2cc(C(F)(F)F)c(C#N)c(SCC(=O)Nc3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C25H20F3N3O3S/c1-3-12-34-19-8-4-16(5-9-19)22-13-21(25(26,27)28)20(14-29)24(31-22)35-15-23(32)30-17-6-10-18(33-2)11-7-17/h3-11,13H,1,12,15H2,2H3,(H,30,32) |
| InChIKey | LSQOCGFWEUZJIS-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|