C28H21F3N4O3S — CID 87047919
2-[[3-cyano-4,6-bis(4-methoxyphenyl)-2-pyridinyl]sulfanyl]-N-[5-(trifluoromethyl)-2-pyridinyl]acetamide (PubChem CID 87047919) has the molecular formula C28H21F3N4O3S and a molecular weight of 550.56 g/mol. Its IUPAC name is 2-[[3-cyano-4,6-bis(4-methoxyphenyl)-2-pyridinyl]sulfanyl]-N-[5-(trifluoromethyl)-2-pyridinyl]acetamide.
| Compound Name | 2-[[3-cyano-4,6-bis(4-methoxyphenyl)-2-pyridinyl]sulfanyl]-N-[5-(trifluoromethyl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 87047919 |
| Molecular Formula | C28H21F3N4O3S |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 2-[[3-cyano-4,6-bis(4-methoxyphenyl)-2-pyridinyl]sulfanyl]-N-[5-(trifluoromethyl)-2-pyridinyl]acetamide |
| SMILES | COc1ccc(-c2cc(-c3ccc(OC)cc3)c(C#N)c(SCC(=O)Nc3ccc(C(F)(F)F)cn3)n2)cc1 |
| InChI | InChI=1S/C28H21F3N4O3S/c1-37-20-8-3-17(4-9-20)22-13-24(18-5-10-21(38-2)11-6-18)34-27(23(22)14-32)39-16-26(36)35-25-12-7-19(15-33-25)28(29,30)31/h3-13,15H,16H2,1-2H3,(H,33,35,36) |
| InChIKey | KDCJDKIUAAQBMT-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|