C16H10F4N2O2S — CID 4778337
methyl 2-[[3-cyano-6-(4-fluorophenyl)-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate (PubChem CID 4778337) has the molecular formula C16H10F4N2O2S and a molecular weight of 370.33 g/mol. Its IUPAC name is methyl 2-[[3-cyano-6-(4-fluorophenyl)-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate.
| Compound Name | methyl 2-[[3-cyano-6-(4-fluorophenyl)-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate |
|---|---|
| PubChem CID | 4778337 |
| Molecular Formula | C16H10F4N2O2S |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | methyl 2-[[3-cyano-6-(4-fluorophenyl)-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nc(-c2ccc(F)cc2)cc(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C16H10F4N2O2S/c1-24-14(23)8-25-15-11(7-21)12(16(18,19)20)6-13(22-15)9-2-4-10(17)5-3-9/h2-6H,8H2,1H3 |
| InChIKey | OWHCWNUOVDDPLW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |