C15H13F3N4S — CID 171788240
6-(methylamino)-2-(2-methylsulfanylanilino)-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 171788240) has the molecular formula C15H13F3N4S and a molecular weight of 338.36 g/mol. Its IUPAC name is 6-(methylamino)-2-(2-methylsulfanylanilino)-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 6-(methylamino)-2-(2-methylsulfanylanilino)-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171788240 |
| Molecular Formula | C15H13F3N4S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 6-(methylamino)-2-(2-methylsulfanylanilino)-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | CNc1cc(C(F)(F)F)c(C#N)c(Nc2ccccc2SC)n1 |
| InChI | InChI=1S/C15H13F3N4S/c1-20-13-7-10(15(16,17)18)9(8-19)14(22-13)21-11-5-3-4-6-12(11)23-2/h3-7H,1-2H3,(H2,20,21,22) |
| InChIKey | QGTKSRRITNVZMB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |