C15H16N2O4 — CID 141268597
4-[[(2E,4E)-5-amino-2-(2-carboxyethyl)penta-2,4-dienylidene]amino]benzoic acid (PubChem CID 141268597) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 4-[[(2E,4E)-5-amino-2-(2-carboxyethyl)penta-2,4-dienylidene]amino]benzoic acid.
| Compound Name | 4-[[(2E,4E)-5-amino-2-(2-carboxyethyl)penta-2,4-dienylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 141268597 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-[[(2E,4E)-5-amino-2-(2-carboxyethyl)penta-2,4-dienylidene]amino]benzoic acid |
| SMILES | N/C=C/C=C(/C=N/c1ccc(C(=O)O)cc1)CCC(=O)O |
| InChI | InChI=1S/C15H16N2O4/c16-9-1-2-11(3-8-14(18)19)10-17-13-6-4-12(5-7-13)15(20)21/h1-2,4-7,9-10H,3,8,16H2,(H,18,19)(H,20,21)/b9-1+,11-2+,17-10+ |
| InChIKey | OFCMYGQZPLGYNW-KJHWIERDSA-N |
| XLogP | 2.35 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|