C11H13N3O3 — CID 143385305
4-amino-4-[(4-hydroxyphenyl)iminomethylimino]butanoic acid (PubChem CID 143385305) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 4-amino-4-[(4-hydroxyphenyl)iminomethylimino]butanoic acid.
| Compound Name | 4-amino-4-[(4-hydroxyphenyl)iminomethylimino]butanoic acid |
|---|---|
| PubChem CID | 143385305 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-amino-4-[(4-hydroxyphenyl)iminomethylimino]butanoic acid |
| SMILES | N/C(CCC(=O)O)=N/C=N/c1ccc(O)cc1 |
| InChI | InChI=1S/C11H13N3O3/c12-10(5-6-11(16)17)14-7-13-8-1-3-9(15)4-2-8/h1-4,7,15H,5-6H2,(H,16,17)(H2,12,13,14) |
| InChIKey | ZHVYIAOCPVGYLC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|