C38H44N2O7Si2 — CID 136792220
4-[[[4-[4-[[4-[4-[(4-hydroxyphenyl)methylideneamino]phenoxy]phenyl]iminomethyl]phenoxy]-4-oxobutyl]-dimethylsilyl]oxy-dimethylsilyl]butanoic acid (PubChem CID 136792220) has the molecular formula C38H44N2O7Si2 and a molecular weight of 696.95 g/mol. Its IUPAC name is 4-[[[4-[4-[[4-[4-[(4-hydroxyphenyl)methylideneamino]phenoxy]phenyl]iminomethyl]phenoxy]-4-oxobutyl]-dimethylsilyl]oxy-dimethylsilyl]butanoic acid.
| Compound Name | 4-[[[4-[4-[[4-[4-[(4-hydroxyphenyl)methylideneamino]phenoxy]phenyl]iminomethyl]phenoxy]-4-oxobutyl]-dimethylsilyl]oxy-dimethylsilyl]butanoic acid |
|---|---|
| PubChem CID | 136792220 |
| Molecular Formula | C38H44N2O7Si2 |
| Molecular Weight | 696.95 g/mol |
| Exact Mass | 696.27 |
| IUPAC Name | 4-[[[4-[4-[[4-[4-[(4-hydroxyphenyl)methylideneamino]phenoxy]phenyl]iminomethyl]phenoxy]-4-oxobutyl]-dimethylsilyl]oxy-dimethylsilyl]butanoic acid |
| SMILES | C[Si](C)(CCCC(=O)O)O[Si](C)(C)CCCC(=O)Oc1ccc(/C=N/c2ccc(Oc3ccc(/N=C/c4ccc(O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H44N2O7Si2/c1-48(2,25-5-7-37(42)43)47-49(3,4)26-6-8-38(44)46-36-19-11-30(12-20-36)28-40-32-15-23-35(24-16-32)45-34-21-13-31(14-22-34)39-27-29-9-17-33(41)18-10-29/h9-24,27-28,41H,5-8,25-26H2,1-4H3,(H,42,43)/b39-27+,40-28+ |
| InChIKey | SKBVJVSSBCBGPS-SDOZPZOWSA-N |
| XLogP | 9.66 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.95 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|