C24H29NO5 — CID 3084908
[4-[(4-pentoxycarbonyloxyphenyl)iminomethyl]phenyl] pentanoate (PubChem CID 3084908) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is [4-[(4-pentoxycarbonyloxyphenyl)iminomethyl]phenyl] pentanoate.
| Compound Name | [4-[(4-pentoxycarbonyloxyphenyl)iminomethyl]phenyl] pentanoate |
|---|---|
| PubChem CID | 3084908 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | [4-[(4-pentoxycarbonyloxyphenyl)iminomethyl]phenyl] pentanoate |
| SMILES | CCCCCOC(=O)Oc1ccc(/N=C/c2ccc(OC(=O)CCCC)cc2)cc1 |
| InChI | InChI=1S/C24H29NO5/c1-3-5-7-17-28-24(27)30-22-15-11-20(12-16-22)25-18-19-9-13-21(14-10-19)29-23(26)8-6-4-2/h9-16,18H,3-8,17H2,1-2H3/b25-18+ |
| InChIKey | AMHOXZKEIVGXFJ-XIEYBQDHSA-N |
| XLogP | 6.24 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|