C17H17BrN2O2S — CID 173012261
2-(1-anilino-3-phenyliminoprop-1-en-2-yl)sulfanylacetic acid;hydrobromide (PubChem CID 173012261) has the molecular formula C17H17BrN2O2S and a molecular weight of 393.31 g/mol. Its IUPAC name is 2-(1-anilino-3-phenyliminoprop-1-en-2-yl)sulfanylacetic acid;hydrobromide.
| Compound Name | 2-(1-anilino-3-phenyliminoprop-1-en-2-yl)sulfanylacetic acid;hydrobromide |
|---|---|
| PubChem CID | 173012261 |
| Molecular Formula | C17H17BrN2O2S |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 2-(1-anilino-3-phenyliminoprop-1-en-2-yl)sulfanylacetic acid;hydrobromide |
| SMILES | Br.O=C(O)CSC(=CNc1ccccc1)/C=N/c1ccccc1 |
| InChI | InChI=1S/C17H16N2O2S.BrH/c20-17(21)13-22-16(11-18-14-7-3-1-4-8-14)12-19-15-9-5-2-6-10-15;/h1-12,18H,13H2,(H,20,21);1H/b16-11?,19-12+; |
| InChIKey | JVPIKDFDNMLWOA-CPHNURGISA-N |
| XLogP | 4.74 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|