C16H17N — CID 155273874
N-[(1E,3Z)-4-cyclohexa-1,5-dien-1-ylbuta-1,3-dienyl]aniline (PubChem CID 155273874) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is N-[(1E,3Z)-4-cyclohexa-1,5-dien-1-ylbuta-1,3-dienyl]aniline.
| Compound Name | N-[(1E,3Z)-4-cyclohexa-1,5-dien-1-ylbuta-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 155273874 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N-[(1E,3Z)-4-cyclohexa-1,5-dien-1-ylbuta-1,3-dienyl]aniline |
| SMILES | C1=CC(/C=C\C=C\Nc2ccccc2)=CCC1 |
| InChI | InChI=1S/C16H17N/c1-3-9-15(10-4-1)11-7-8-14-17-16-12-5-2-6-13-16/h2-3,5-14,17H,1,4H2/b11-7-,14-8+ |
| InChIKey | PVNPSDYVDVYXSM-WIFBXHMDSA-N |
| XLogP | 4.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|