C12H14N2 — CID 155699448
1-cyclohexa-1,5-dien-1-yl-2-phenylhydrazine (PubChem CID 155699448) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-2-phenylhydrazine.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-2-phenylhydrazine |
|---|---|
| PubChem CID | 155699448 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-2-phenylhydrazine |
| SMILES | C1=CC(NNc2ccccc2)=CCC1 |
| InChI | InChI=1S/C12H14N2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1,3-5,7-10,13-14H,2,6H2 |
| InChIKey | BPGQXHNLMLGWPI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|