C24H12F2N4 — CID 140701459
4-[4-(2-cyano-5-fluoro-4-isocyanophenyl)-2,5-dimethylphenyl]-6-fluorobenzene-1,3-dicarbonitrile (PubChem CID 140701459) has the molecular formula C24H12F2N4 and a molecular weight of 394.38 g/mol. Its IUPAC name is 4-[4-(2-cyano-5-fluoro-4-isocyanophenyl)-2,5-dimethylphenyl]-6-fluorobenzene-1,3-dicarbonitrile.
| Compound Name | 4-[4-(2-cyano-5-fluoro-4-isocyanophenyl)-2,5-dimethylphenyl]-6-fluorobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 140701459 |
| Molecular Formula | C24H12F2N4 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 4-[4-(2-cyano-5-fluoro-4-isocyanophenyl)-2,5-dimethylphenyl]-6-fluorobenzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)c(-c2cc(C)c(-c3cc(F)c(C#N)cc3C#N)cc2C)cc1F |
| InChI | InChI=1S/C24H12F2N4/c1-13-5-19(21-9-23(26)24(30-3)7-16(21)11-28)14(2)4-18(13)20-8-22(25)17(12-29)6-15(20)10-27/h4-9H,1-2H3 |
| InChIKey | XCHHPODESNHRFT-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 75.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|