C16H4F2N4 — CID 140701563
4-(2-cyano-5-fluoro-4-isocyanophenyl)-6-fluorobenzene-1,3-dicarbonitrile (PubChem CID 140701563) has the molecular formula C16H4F2N4 and a molecular weight of 290.23 g/mol. Its IUPAC name is 4-(2-cyano-5-fluoro-4-isocyanophenyl)-6-fluorobenzene-1,3-dicarbonitrile.
| Compound Name | 4-(2-cyano-5-fluoro-4-isocyanophenyl)-6-fluorobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 140701563 |
| Molecular Formula | C16H4F2N4 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-(2-cyano-5-fluoro-4-isocyanophenyl)-6-fluorobenzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)c(-c2cc(F)c(C#N)cc2C#N)cc1F |
| InChI | InChI=1S/C16H4F2N4/c1-22-16-3-10(7-20)13(5-15(16)18)12-4-14(17)11(8-21)2-9(12)6-19/h2-5H |
| InChIKey | DTUOHBRDGUMDCO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|