C27H10F3N5 — CID 171766778
4-[2-[2,4-bis(cyanomethyl)-5-[2-(2,5-difluoro-4-isocyanophenyl)ethynyl]phenyl]ethynyl]-5-fluoropyridine-2-carbonitrile (PubChem CID 171766778) has the molecular formula C27H10F3N5 and a molecular weight of 461.41 g/mol. Its IUPAC name is 4-[2-[2,4-bis(cyanomethyl)-5-[2-(2,5-difluoro-4-isocyanophenyl)ethynyl]phenyl]ethynyl]-5-fluoropyridine-2-carbonitrile.
| Compound Name | 4-[2-[2,4-bis(cyanomethyl)-5-[2-(2,5-difluoro-4-isocyanophenyl)ethynyl]phenyl]ethynyl]-5-fluoropyridine-2-carbonitrile |
|---|---|
| PubChem CID | 171766778 |
| Molecular Formula | C27H10F3N5 |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 4-[2-[2,4-bis(cyanomethyl)-5-[2-(2,5-difluoro-4-isocyanophenyl)ethynyl]phenyl]ethynyl]-5-fluoropyridine-2-carbonitrile |
| SMILES | [C-]#[N+]c1cc(F)c(C#Cc2cc(C#Cc3cc(C#N)ncc3F)c(CC#N)cc2CC#N)cc1F |
| InChI | InChI=1S/C27H10F3N5/c1-34-27-14-24(28)22(13-25(27)29)5-3-18-10-17(19(6-8-31)11-20(18)7-9-32)2-4-21-12-23(15-33)35-16-26(21)30/h10-14,16H,6-7H2 |
| InChIKey | KPZWCTNQQVSGQW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|