C40H26F6N4 — CID 162264311
2-fluoro-4-[2-fluoro-4-[2-fluoro-4-[[3-fluoro-4-[3-fluoro-4-(3-fluoro-4-isocyanophenyl)phenyl]phenyl]methyl]phenyl]phenyl]benzonitrile;methanediamine (PubChem CID 162264311) has the molecular formula C40H26F6N4 and a molecular weight of 676.66 g/mol. Its IUPAC name is 2-fluoro-4-[2-fluoro-4-[2-fluoro-4-[[3-fluoro-4-[3-fluoro-4-(3-fluoro-4-isocyanophenyl)phenyl]phenyl]methyl]phenyl]phenyl]benzonitrile;methanediamine.
| Compound Name | 2-fluoro-4-[2-fluoro-4-[2-fluoro-4-[[3-fluoro-4-[3-fluoro-4-(3-fluoro-4-isocyanophenyl)phenyl]phenyl]methyl]phenyl]phenyl]benzonitrile;methanediamine |
|---|---|
| PubChem CID | 162264311 |
| Molecular Formula | C40H26F6N4 |
| Molecular Weight | 676.66 g/mol |
| Exact Mass | 676.21 |
| IUPAC Name | 2-fluoro-4-[2-fluoro-4-[2-fluoro-4-[[3-fluoro-4-[3-fluoro-4-(3-fluoro-4-isocyanophenyl)phenyl]phenyl]methyl]phenyl]phenyl]benzonitrile;methanediamine |
| SMILES | NCN.[C-]#[N+]c1ccc(-c2ccc(-c3ccc(Cc4ccc(-c5ccc(-c6ccc(C#N)c(F)c6)c(F)c5)c(F)c4)cc3F)cc2F)cc1F |
| InChI | InChI=1S/C39H20F6N2.CH6N2/c1-47-39-13-8-27(20-38(39)45)32-12-7-26(19-37(32)44)30-10-3-23(16-35(30)42)14-22-2-9-29(34(41)15-22)25-6-11-31(36(43)18-25)24-4-5-28(21-46)33(40)17-24;2-1-3/h2-13,15-20H,14H2;1-3H2 |
| InChIKey | ZZRLNMBHRYPZBT-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 80.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.66 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|