C37H32F2N2O4 — CID 123648083
(4-cyano-3-fluorophenyl) 4-[9-[4-(3-fluoro-4-isocyanophenoxy)carbonylphenyl]nonyl]benzoate (PubChem CID 123648083) has the molecular formula C37H32F2N2O4 and a molecular weight of 606.67 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 4-[9-[4-(3-fluoro-4-isocyanophenoxy)carbonylphenyl]nonyl]benzoate.
| Compound Name | (4-cyano-3-fluorophenyl) 4-[9-[4-(3-fluoro-4-isocyanophenoxy)carbonylphenyl]nonyl]benzoate |
|---|---|
| PubChem CID | 123648083 |
| Molecular Formula | C37H32F2N2O4 |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 4-[9-[4-(3-fluoro-4-isocyanophenoxy)carbonylphenyl]nonyl]benzoate |
| SMILES | [C-]#[N+]c1ccc(OC(=O)c2ccc(CCCCCCCCCc3ccc(C(=O)Oc4ccc(C#N)c(F)c4)cc3)cc2)cc1F |
| InChI | InChI=1S/C37H32F2N2O4/c1-41-35-22-21-32(24-34(35)39)45-37(43)29-17-13-27(14-18-29)10-8-6-4-2-3-5-7-9-26-11-15-28(16-12-26)36(42)44-31-20-19-30(25-40)33(38)23-31/h11-24H,2-10H2 |
| InChIKey | IHBWFNPWXCDMHU-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|