C42H21F6NO4 — CID 144581650
[4-(4-ethynyl-3-fluorophenyl)-3-fluorophenyl] 4-[[4-[4-(4-cyano-3-fluorophenyl)-3-fluorophenoxy]carbonyl-3-fluorophenyl]methyl]-2-fluorobenzoate (PubChem CID 144581650) has the molecular formula C42H21F6NO4 and a molecular weight of 717.62 g/mol. Its IUPAC name is [4-(4-ethynyl-3-fluorophenyl)-3-fluorophenyl] 4-[[4-[4-(4-cyano-3-fluorophenyl)-3-fluorophenoxy]carbonyl-3-fluorophenyl]methyl]-2-fluorobenzoate.
| Compound Name | [4-(4-ethynyl-3-fluorophenyl)-3-fluorophenyl] 4-[[4-[4-(4-cyano-3-fluorophenyl)-3-fluorophenoxy]carbonyl-3-fluorophenyl]methyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 144581650 |
| Molecular Formula | C42H21F6NO4 |
| Molecular Weight | 717.62 g/mol |
| Exact Mass | 717.14 |
| IUPAC Name | [4-(4-ethynyl-3-fluorophenyl)-3-fluorophenyl] 4-[[4-[4-(4-cyano-3-fluorophenyl)-3-fluorophenoxy]carbonyl-3-fluorophenyl]methyl]-2-fluorobenzoate |
| SMILES | C#Cc1ccc(-c2ccc(OC(=O)c3ccc(Cc4ccc(C(=O)Oc5ccc(-c6ccc(C#N)c(F)c6)c(F)c5)c(F)c4)cc3F)cc2F)cc1F |
| InChI | InChI=1S/C42H21F6NO4/c1-2-25-5-6-26(18-35(25)43)31-13-9-29(20-39(31)47)52-41(50)33-11-3-23(16-37(33)45)15-24-4-12-34(38(46)17-24)42(51)53-30-10-14-32(40(48)21-30)27-7-8-28(22-49)36(44)19-27/h1,3-14,16-21H,15H2 |
| InChIKey | DXVAAQVBYORNTN-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.62 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|