C50H42F4N2O4 — CID 144847426
[4-(4-cyanophenyl)-3-fluorophenyl] 2-fluoro-4-[9-(3-fluoro-4-formylphenyl)nonyl]benzoate;4-(2-fluoro-4-methoxyphenyl)benzonitrile (PubChem CID 144847426) has the molecular formula C50H42F4N2O4 and a molecular weight of 810.89 g/mol. Its IUPAC name is [4-(4-cyanophenyl)-3-fluorophenyl] 2-fluoro-4-[9-(3-fluoro-4-formylphenyl)nonyl]benzoate;4-(2-fluoro-4-methoxyphenyl)benzonitrile.
| Compound Name | [4-(4-cyanophenyl)-3-fluorophenyl] 2-fluoro-4-[9-(3-fluoro-4-formylphenyl)nonyl]benzoate;4-(2-fluoro-4-methoxyphenyl)benzonitrile |
|---|---|
| PubChem CID | 144847426 |
| Molecular Formula | C50H42F4N2O4 |
| Molecular Weight | 810.89 g/mol |
| Exact Mass | 810.31 |
| IUPAC Name | [4-(4-cyanophenyl)-3-fluorophenyl] 2-fluoro-4-[9-(3-fluoro-4-formylphenyl)nonyl]benzoate;4-(2-fluoro-4-methoxyphenyl)benzonitrile |
| SMILES | COc1ccc(-c2ccc(C#N)cc2)c(F)c1.N#Cc1ccc(-c2ccc(OC(=O)c3ccc(CCCCCCCCCc4ccc(C=O)c(F)c4)cc3F)cc2F)cc1 |
| InChI | InChI=1S/C36H32F3NO3.C14H10FNO/c37-33-20-25(10-16-29(33)24-41)8-6-4-2-1-3-5-7-9-26-13-18-32(34(38)21-26)36(42)43-30-17-19-31(35(39)22-30)28-14-11-27(23-40)12-15-28;1-17-12-6-7-13(14(15)8-12)11-4-2-10(9-16)3-5-11/h10-22,24H,1-9H2;2-8H,1H3 |
| InChIKey | QCJONTCIRDQQLE-UHFFFAOYSA-N |
| XLogP | 12.56 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.89 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|