C16H13F3N2O3 — CID 90899998
(4-cyano-3,5-difluorophenyl) 2-fluoro-4-methoxybenzoate;methanamine (PubChem CID 90899998) has the molecular formula C16H13F3N2O3 and a molecular weight of 338.29 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) 2-fluoro-4-methoxybenzoate;methanamine.
| Compound Name | (4-cyano-3,5-difluorophenyl) 2-fluoro-4-methoxybenzoate;methanamine |
|---|---|
| PubChem CID | 90899998 |
| Molecular Formula | C16H13F3N2O3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) 2-fluoro-4-methoxybenzoate;methanamine |
| SMILES | CN.COc1ccc(C(=O)Oc2cc(F)c(C#N)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C15H8F3NO3.CH5N/c1-21-8-2-3-10(12(16)4-8)15(20)22-9-5-13(17)11(7-19)14(18)6-9;1-2/h2-6H,1H3;2H2,1H3 |
| InChIKey | FBHINUIDRQXTTR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|