C17H12F3NO2 — CID 163543701
(4-cyano-3,5-difluorophenyl) 3-fluoro-4-propylbenzoate (PubChem CID 163543701) has the molecular formula C17H12F3NO2 and a molecular weight of 319.28 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) 3-fluoro-4-propylbenzoate.
| Compound Name | (4-cyano-3,5-difluorophenyl) 3-fluoro-4-propylbenzoate |
|---|---|
| PubChem CID | 163543701 |
| Molecular Formula | C17H12F3NO2 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) 3-fluoro-4-propylbenzoate |
| SMILES | CCCc1ccc(C(=O)Oc2cc(F)c(C#N)c(F)c2)cc1F |
| InChI | InChI=1S/C17H12F3NO2/c1-2-3-10-4-5-11(6-14(10)18)17(22)23-12-7-15(19)13(9-21)16(20)8-12/h4-8H,2-3H2,1H3 |
| InChIKey | FDFKPMDGLQAULE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|